3-Bromo-N,N-bis(trimethylsilyl)propan-1-amine - CAS 172851-95-5
Catalog: |
BB012859 |
Product Name: |
3-Bromo-N,N-bis(trimethylsilyl)propan-1-amine |
CAS: |
172851-95-5 |
Synonyms: |
3-bromo-N,N-bis(trimethylsilyl)propan-1-amine |
IUPAC Name: | 3-bromo-N,N-bis(trimethylsilyl)propan-1-amine |
Description: | 3-Bromo-N,N-bis(trimethylsilyl)propan-1-amine (CAS# 172851-95-5) is a useful research chemical. |
Molecular Weight: | 282.37 |
Molecular Formula: | C9H24BrNSi2 |
Canonical SMILES: | C[Si](C)(C)N(CCCBr)[Si](C)(C)C |
InChI: | InChI=1S/C9H24BrNSi2/c1-12(2,3)11(9-7-8-10)13(4,5)6/h7-9H2,1-6H3 |
InChI Key: | NCITYJREKCYVGX-UHFFFAOYSA-N |
Purity: | 98 % |
LogP: | 3.74320 |
Publication Number | Title | Priority Date |
US-2011257156-A1 | Gamma secretase modulators | 20081106 |
US-2011263529-A1 | Gamma secretase modulators | 20081106 |
EP-2307461-A1 | Polymers functionalized with imide compounds containing a protected amino group | 20080703 |
US-2010004414-A1 | Polymers functionalized with imide compounds containing a protected amino group | 20080703 |
US-2011144282-A1 | Polymers functionalized with imide compounds containing a protected amino group | 20080703 |
Complexity: | 135 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 281.06307 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 281.06307 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 3.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS