3-Bromo-N-ethylaniline - CAS 398151-69-4
Catalog: |
BB024147 |
Product Name: |
3-Bromo-N-ethylaniline |
CAS: |
398151-69-4 |
Synonyms: |
3-bromo-N-ethylaniline; 3-bromo-N-ethylaniline |
IUPAC Name: | 3-bromo-N-ethylaniline |
Description: | 3-Bromo-N-ethylaniline (CAS# 398151-69-4) is a useful research chemical. |
Molecular Weight: | 200.08 |
Molecular Formula: | C8H10BrN |
Canonical SMILES: | CCNC1=CC(=CC=C1)Br |
InChI: | InChI=1S/C8H10BrN/c1-2-10-8-5-3-4-7(9)6-8/h3-6,10H,2H2,1H3 |
InChI Key: | KBCJPWUCWTXJEW-UHFFFAOYSA-N |
LogP: | 2.95390 |
Publication Number | Title | Priority Date |
WO-2021130638-A1 | Diacylglycerol kinase modulating compounds | 20191224 |
CN-108912141-A | Gram-Negative bacillus inhibitor and its preparation and application | 20180719 |
TW-201730192-A | Novel substituted spiro-[porphyrin heterocycloalkane] compounds as phosphodiesterase inhibitors | 20151222 |
WO-2017108204-A1 | Novel substituted spiro-[indoline heterocycloalkane] compounds as phosphodiesterase inhibitors | 20151222 |
JP-2016056123-A | 2-Benzyloxy-5- (trifluoromethyl) pyrimidine derivative and method for producing the same | 20140909 |
Complexity: | 95.3 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 198.99966 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 198.99966 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 12 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS