3-Bromo-6-methylpyridine-2-carbonitrile - CAS 717843-48-6
Catalog: |
BB034475 |
Product Name: |
3-Bromo-6-methylpyridine-2-carbonitrile |
CAS: |
717843-48-6 |
Synonyms: |
3-bromo-6-methyl-2-pyridinecarbonitrile; 3-bromo-6-methylpyridine-2-carbonitrile |
IUPAC Name: | 3-bromo-6-methylpyridine-2-carbonitrile |
Description: | 3-Bromo-6-methylpyridine-2-carbonitrile (CAS# 717843-48-6) is a useful research chemical. |
Molecular Weight: | 197.03 |
Molecular Formula: | C7H5BrN2 |
Canonical SMILES: | CC1=NC(=C(C=C1)Br)C#N |
InChI: | InChI=1S/C7H5BrN2/c1-5-2-3-6(8)7(4-9)10-5/h2-3H,1H3 |
InChI Key: | ARSYSTQQVJUEBW-UHFFFAOYSA-N |
Boiling Point: | 299.304 °C at 760 mmHg |
Density: | 1.613 g/cm3 |
Appearance: | Solid |
MDL: | MFCD08059560 |
LogP: | 2.02418 |
Publication Number | Title | Priority Date |
WO-2021115286-A1 | Six-membered and five-membered aromatic ring derivative containing nitrogen heteroatoms which can be used as shp2 inhibitor | 20191210 |
WO-2021011713-A1 | Imidazopyrimidines as eed inhibitors and the use thereof | 20190716 |
WO-2020160213-A1 | Heteroarylmethylene derivatives as dna polymerase theta inhibitors | 20190131 |
TW-202039528-A | Neuroactive steroids and their methods of use | 20181205 |
WO-2019192992-A1 | Antimalarial hexahydropyrimidine analogues | 20180406 |
Complexity: | 160 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.96361 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.96361 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 36.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS