3-Bromo-5-iodobenzaldehyde - CAS 188813-09-4
Catalog: |
BB014555 |
Product Name: |
3-Bromo-5-iodobenzaldehyde |
CAS: |
188813-09-4 |
Synonyms: |
3-bromo-5-iodobenzaldehyde; 3-bromo-5-iodobenzaldehyde |
IUPAC Name: | 3-bromo-5-iodobenzaldehyde |
Description: | 3-Bromo-5-iodobenzaldehyde (CAS# 188813-09-4 ) is a useful research chemical. |
Molecular Weight: | 310.91 |
Molecular Formula: | C7H4BrIO |
Canonical SMILES: | C1=C(C=C(C=C1Br)I)C=O |
InChI: | InChI=1S/C7H4BrIO/c8-6-1-5(4-10)2-7(9)3-6/h1-4H |
InChI Key: | XZXJUWDREBPKRI-UHFFFAOYSA-N |
Boiling Point: | 318.433 °C at 760 mmHg |
Density: | 2.231 g/cm3 |
LogP: | 2.86620 |
Publication Number | Title | Priority Date |
US-2021130303-A1 | Ras inhibitors | 20191104 |
WO-2021091982-A1 | Ras inhibitors | 20191104 |
AU-2018355709-A1 | Novel macrocyclic derivatives, process for preparing same and pharmaceutical compositions containing same | 20171025 |
CA-3080116-A1 | Macrocyclic derivatives, their preparation process and the pharmaceutical compositions containing them | 20171025 |
TW-201922754-A | Novel macrocyclic compound, preparation method thereof and pharmaceutical composition containing same | 20171025 |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 309.84902 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 309.84902 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS