3-Bromo-4-pyrrolidinobenzoic Acid - CAS 1131615-12-7
Catalog: |
BB003128 |
Product Name: |
3-Bromo-4-pyrrolidinobenzoic Acid |
CAS: |
1131615-12-7 |
Synonyms: |
3-bromo-4-(1-pyrrolidinyl)benzoic acid; 3-bromo-4-pyrrolidin-1-ylbenzoic acid |
IUPAC Name: | 3-bromo-4-pyrrolidin-1-ylbenzoic acid |
Description: | 3-Bromo-4-pyrrolidinobenzoic Acid (CAS# 1131615-12-7 ) is a useful research chemical. |
Molecular Weight: | 270.12 |
Molecular Formula: | C11H12BrNO2 |
Canonical SMILES: | C1CCN(C1)C2=C(C=C(C=C2)C(=O)O)Br |
InChI: | InChI=1S/C11H12BrNO2/c12-9-7-8(11(14)15)3-4-10(9)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H,14,15) |
InChI Key: | IYVTXKFQNGDTPN-UHFFFAOYSA-N |
Storage: | Sealed in dry, 2-8 °C |
LogP: | 2.81250 |
Publication Number | Title | Priority Date |
AU-2018246563-A1 | 4-Pyridone compound or salt thereof, and pharmaceutical composition and formulation including same | 20170331 |
CA-3058111-A1 | 4-pyridone compound or salt thereof, and pharmaceutical composition and formulation including same | 20170331 |
CN-110475775-A | 4- pyridinone compounds or its salt, pharmaceutical composition and agent comprising 4- pyridinone compounds | 20170331 |
EP-3604301-A1 | 4-pyridone compound or salt thereof, and pharmaceutical composition and formulation including same | 20170331 |
JP-WO2018181883-A1 | 4-pyridone compound or salt thereof, pharmaceutical composition and agent containing the same | 20170331 |
Complexity: | 241 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 269.00514 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 269.00514 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 40.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS