3-Bromo-4-nitroindole - CAS 126807-08-7
Catalog: |
BB006667 |
Product Name: |
3-Bromo-4-nitroindole |
CAS: |
126807-08-7 |
Synonyms: |
3-bromo-4-nitro-1H-indole; 3-bromo-4-nitro-1H-indole |
IUPAC Name: | 3-bromo-4-nitro-1H-indole |
Description: | 3-Bromo-4-nitroindole (CAS# 126807-08-7) is a useful research chemical. |
Molecular Weight: | 241.04 |
Molecular Formula: | C8H5BrN2O2 |
Canonical SMILES: | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=CN2)Br |
InChI: | InChI=1S/C8H5BrN2O2/c9-5-4-10-6-2-1-3-7(8(5)6)11(12)13/h1-4,10H |
InChI Key: | VYQRPDVMVMLVHA-UHFFFAOYSA-N |
Appearance: | Solid |
MDL: | MFCD04973972 |
LogP: | 3.36180 |
Publication Number | Title | Priority Date |
US-2014275541-A1 | Total synthesis of thaxtomin a analogues and their intermediates | 20130315 |
US-8993762-B2 | Total synthesis of thaxtomin A analogues and their intermediates | 20130315 |
WO-2014149171-A1 | Total synthesis of thaxtomin a analogues and their intermediates | 20130315 |
KR-20140002476-A | Pyrimidine conjugated derivatives having FMS kinase inhibitory activity | 20120629 |
WO-2014003483-A1 | Fused pyrimidine derivatives having inhibitory activity on fms kinases | 20120629 |
Complexity: | 219 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 239.95344 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 239.95344 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 61.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS