3-Bromo-4-hydroxyquinoline - CAS 64965-47-5
Catalog: |
BB032602 |
Product Name: |
3-Bromo-4-hydroxyquinoline |
CAS: |
64965-47-5 |
Synonyms: |
3-bromo-1H-quinolin-4-one |
IUPAC Name: | 3-bromo-1H-quinolin-4-one |
Description: | 3-Bromo-4-hydroxyquinoline (CAS# 64965-47-5) is a useful research chemical. |
Molecular Weight: | 224.05 |
Molecular Formula: | C9H6BrNO |
Canonical SMILES: | C1=CC=C2C(=C1)C(=O)C(=CN2)Br |
InChI: | InChI=1S/C9H6BrNO/c10-7-5-11-8-4-2-1-3-6(8)9(7)12/h1-5H,(H,11,12) |
InChI Key: | NOJARSKUXYDSJA-UHFFFAOYSA-N |
Boiling Point: | 290.6 °C at 760 mmHg |
Density: | 1.666 g/cm3 |
LogP: | 2.70290 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]; H318 (100%): Causes serious eye damage [Danger Serious eye damage/eye irritation] |
Precautionary Statement: | P264, P264+P265, P270, P280, P301+P316, P305+P354+P338, P317, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021151062-A1 | Heterocyclic compounds and uses thereof | 20200124 |
CN-110944991-A | Heterocyclic compound and organic light emitting device including the same | 20180109 |
KR-20190084855-A | Hetero-cyclic compound and organic light emitting device comprising the same | 20180109 |
WO-2019139233-A1 | Heterocyclic compound and organic light emitting element using same | 20180109 |
KR-102126884-B1 | Hetero-cyclic compound and organic light emitting device comprising the same | 20180109 |
Complexity: | 237 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 222.96328 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 222.96328 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 29.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS