3-Bromo-4-chlorobenzyl bromide - CAS 880348-24-3
Catalog: |
BB055265 |
Product Name: |
3-Bromo-4-chlorobenzyl bromide |
CAS: |
880348-24-3 |
Synonyms: |
2-Bromo-4-(bromomethyl)-1-chlorobenzene; 3-Bromo-4-chlorobenzyl bromide; Benzene, 2-bromo-4-(bromomethyl)-1-chloro-; 3-Bromo-4-chloro benzyl bromide |
IUPAC Name: | 2-bromo-4-(bromomethyl)-1-chlorobenzene |
Description: | 3-Bromo-4-chlorobenzyl bromide |
Molecular Weight: | 284.38 |
Molecular Formula: | C7H5Br2Cl |
Canonical SMILES: | C1=CC(=C(C=C1CBr)Br)Cl |
InChI: | InChI=1S/C7H5Br2Cl/c8-4-5-1-2-7(10)6(9)3-5/h1-3H,4H2 |
InChI Key: | ZXIWBVSODJAUTC-UHFFFAOYSA-N |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021247910-A1 | Amino alcohol compounds and uses thereof | 20200603 |
WO-2019106368-A1 | Pyrrolo[3,2-c]pyridin-4-one derivatives as pfk inhibitors useful for the treatment of protozoal infections | 20171201 |
AU-2018283422-A1 | Herbicidal pyrimidine compounds | 20170614 |
CA-3064513-A1 | Herbicidal pyrimidine compounds | 20170614 |
EP-3638033-A1 | Herbicidal pyrimidine compounds | 20170614 |
US-2020146289-A1 | Herbicidal pyrimidine compounds | 20170614 |
WO-2018229041-A1 | Herbicidal pyrimidine compounds | 20170614 |
US-2016355504-A1 | Heteroaryl inhibitors of sumo activating enzyme | 20130702 |
US-9695154-B2 | Heteroaryl inhibitors of sumo activating enzyme | 20130702 |
WO-2015002994-A2 | Heteroaryl compounds useful as inhibitors of sumo activating enzyme | 20130702 |
Complexity: | 108 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 283.8426 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 281.84465 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS