3-Bromo-2-fluoro-5-nitropyridine - CAS 1868-58-2
Catalog: |
BB014376 |
Product Name: |
3-Bromo-2-fluoro-5-nitropyridine |
CAS: |
1868-58-2 |
Synonyms: |
3-bromo-2-fluoro-5-nitropyridine; 3-bromo-2-fluoro-5-nitropyridine |
IUPAC Name: | 3-bromo-2-fluoro-5-nitropyridine |
Description: | 3-Bromo-2-fluoro-5-nitropyridine (CAS# 1868-58-2) is a useful research chemical. |
Molecular Weight: | 220.98 |
Molecular Formula: | C5H2BrFN2O2 |
Canonical SMILES: | C1=C(C=NC(=C1Br)F)[N+](=O)[O-] |
InChI: | InChI=1S/C5H2BrFN2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H |
InChI Key: | NLLPMLSUMJHTCJ-UHFFFAOYSA-N |
Boiling Point: | 265.4 °C at 760 mmHg |
Density: | 1.923 g/cm3 |
LogP: | 2.41460 |
Publication Number | Title | Priority Date |
US-2020235306-A1 | Organic compound and organic electroluminescence device using the same | 20190120 |
WO-2020020288-A1 | Sulfoximine compound as bromodomain protein inhibitor and pharmaceutical composition and medical use thereof | 20180725 |
CN-112424200-A | Iminosulfones compound as bromodomain protein inhibitor, pharmaceutical composition and medical application thereof | 20180725 |
KR-20210038921-A | Sulfoximine compounds and pharmaceutical compositions as bromodomain protein inhibitors and their medical use | 20180725 |
EP-3828183-A1 | Sulfoximine compound as bromodomain protein inhibitor and pharmaceutical composition and medical use thereof | 20180725 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 219.92837 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 219.92837 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS