3-Bromo-2-chloro-5-(hydroxymethyl)pyridine - CAS 904745-59-1
Catalog: |
BB039863 |
Product Name: |
3-Bromo-2-chloro-5-(hydroxymethyl)pyridine |
CAS: |
904745-59-1 |
Synonyms: |
(5-bromo-6-chloro-3-pyridinyl)methanol; (5-bromo-6-chloropyridin-3-yl)methanol |
IUPAC Name: | (5-bromo-6-chloropyridin-3-yl)methanol |
Description: | 3-Bromo-2-chloro-5-(hydroxymethyl)pyridine (CAS# 904745-59-1) is a useful research chemical. |
Molecular Weight: | 222.47 |
Molecular Formula: | C6H5BrClNO |
Canonical SMILES: | C1=C(C=NC(=C1Br)Cl)CO |
InChI: | InChI=1S/C6H5BrClNO/c7-5-1-4(3-10)2-9-6(5)8/h1-2,10H,3H2 |
InChI Key: | QWDIYYDBPYBDCM-UHFFFAOYSA-N |
MDL: | MFCD15526782 |
LogP: | 1.98980 |
Publication Number | Title | Priority Date |
WO-2021026672-A1 | Heterocyclic wdr5 inhibitors as anti-cancer compounds | 20190809 |
WO-2021028806-A1 | Heterocyclic wdr5 inhibitors as anti-cancer compounds | 20190809 |
WO-2019141131-A1 | Bromodomain inhibitor compound and use thereof | 20180116 |
CA-3030949-A1 | Guanidine derivative and medical use thereof | 20160729 |
EP-3495348-A1 | Guanidine derivative and use thereof for medical purposes | 20160729 |
Complexity: | 114 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 220.9243 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 220.9243 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 33.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS