3-Bromo-1,2-benzoxazole - CAS 1263178-34-2
Catalog: |
BB006561 |
Product Name: |
3-Bromo-1,2-benzoxazole |
CAS: |
1263178-34-2 |
Synonyms: |
3-bromo-1,2-benzoxazole; 3-bromo-1,2-benzoxazole |
IUPAC Name: | 3-bromo-1,2-benzoxazole |
Description: | 3-Bromo-1,2-benzoxazole (CAS# 1263178-34-2) is a useful research chemical. |
Molecular Weight: | 198.02 |
Molecular Formula: | C7H4BrNO |
Canonical SMILES: | C1=CC=C2C(=C1)C(=NO2)Br |
InChI: | InChI=1S/C7H4BrNO/c8-7-5-3-1-2-4-6(5)10-9-7/h1-4H |
InChI Key: | NCIYIIPYKCJIPS-UHFFFAOYSA-N |
LogP: | 2.59030 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020039945-A1 | Compounds | 20180620 |
CN-106518841-A | Cyclohexane derivative or stereoisomer or salt and preparation and application thereof | 20150915 |
AU-2014366940-A1 | Fused heterocyclic compounds as ion channel modulators | 20131220 |
AU-2014366940-B2 | Fused heterocyclic compounds as ion channel modulators | 20131220 |
CA-2934456-C | Fused heterocyclic compounds as ion channel modulators | 20131220 |
Complexity: | 131 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 196.94763 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 196.94763 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzoxazole/Benzothiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS