3-(Aminomethyl)cyclohexanol - CAS 116650-26-1
Catalog: |
BB003782 |
Product Name: |
3-(Aminomethyl)cyclohexanol |
CAS: |
116650-26-1 |
Synonyms: |
3-(aminomethyl)-1-cyclohexanol; 3-(aminomethyl)cyclohexan-1-ol |
IUPAC Name: | 3-(aminomethyl)cyclohexan-1-ol |
Description: | 3-(Aminomethyl)cyclohexanol (CAS# 116650-26-1) is a useful research chemical. |
Molecular Weight: | 129.20 |
Molecular Formula: | C7H15NO |
Canonical SMILES: | C1CC(CC(C1)O)CN |
InChI: | InChI=1S/C7H15NO/c8-5-6-2-1-3-7(9)4-6/h6-7,9H,1-5,8H2 |
InChI Key: | WFTIZANRIDXCBN-UHFFFAOYSA-N |
Appearance: | Solid |
LogP: | 1.19650 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112979646-A | Imidazopyridine derivative | 20210308 |
KR-20210015730-A | Oxo-pyridine fused ring derivatives and pharmaceutical composition containing the same | 20190802 |
WO-2021025407-A1 | Oxo-pyridine fusion ring derivative and pharmaceutical composition comprising same | 20190802 |
WO-2020211672-A1 | Cd73 inhibitors | 20190416 |
WO-2020210938-A1 | Quinazoline derivatives as cd73 inhibitors | 20190415 |
Complexity: | 85 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 129.115364102 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 129.115364102 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 46.2 Å2 |
Undefined Atom Stereocenter Count: | 2 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS