3-(Aminomethyl)-3-fluorooxetane - CAS 883311-82-8
Catalog: |
BB038821 |
Product Name: |
3-(Aminomethyl)-3-fluorooxetane |
CAS: |
883311-82-8 |
Synonyms: |
(3-fluoro-3-oxetanyl)methanamine; (3-fluorooxetan-3-yl)methanamine |
IUPAC Name: | (3-fluorooxetan-3-yl)methanamine |
Description: | 3-(Aminomethyl)-3-fluorooxetane (CAS# 883311-82-8) is a useful research chemical. |
Molecular Weight: | 105.11 |
Molecular Formula: | C4H8FNO |
Canonical SMILES: | C1C(CO1)(CN)F |
InChI: | InChI=1S/C4H8FNO/c5-4(1-6)2-7-3-4/h1-3,6H2 |
InChI Key: | CKOHQNWYAGJORO-UHFFFAOYSA-N |
LogP: | 0.38390 |
Publication Number | Title | Priority Date |
WO-2021175270-A1 | Novel hpk1 inhibitor, preparation method therefor and application thereof | 20200303 |
CN-113348170-A | Biphenyl derivative inhibitor, preparation method and application thereof | 20200103 |
WO-2021130259-A1 | Dihydrocyclopenta-isoquinoline-sulfonamide derivatives compounds | 20191223 |
US-2020352942-A1 | Dosage forms and regimens for amino acid compounds | 20190408 |
WO-2020210404-A1 | Dosage forms and regimens for amino acid compounds | 20190408 |
Complexity: | 72.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 105.058992041 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 105.058992041 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS