3-Amino-6-chloro-1H-indazole - CAS 16889-21-7
Catalog: |
BB012499 |
Product Name: |
3-Amino-6-chloro-1H-indazole |
CAS: |
16889-21-7 |
Synonyms: |
6-chloro-1H-indazol-3-amine; 6-chloro-1H-indazol-3-amine |
IUPAC Name: | 6-chloro-1H-indazol-3-amine |
Description: | 3-Amino-6-chloro-1H-indazole (CAS# 16889-21-7) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 167.60 |
Molecular Formula: | C7H6ClN3 |
Canonical SMILES: | C1=CC2=C(C=C1Cl)NN=C2N |
InChI: | InChI=1S/C7H6ClN3/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,(H3,9,10,11) |
InChI Key: | BPTYMRSBTUERSW-UHFFFAOYSA-N |
Boiling Point: | 408.7 °C at 760 mmHg |
Density: | 1.533 g/cm3 |
LogP: | 2.37970 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020085493-A1 | Novel indazole compound or salt thereof | 20181026 |
TW-202029960-A | Novel indazole compound or its salt | 20181026 |
EP-3871673-A1 | Novel indazole compound or salt thereof | 20181026 |
CN-110818683-A | 2-pyridine substituted urea structure small molecule compound and synthesis and application thereof | 20180810 |
AU-2014345771-A1 | (aza)pyridopyrazolopyrimidinones and indazolopyrimidinones as inhibitors of fibrinolysis | 20131105 |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 167.0250249 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 167.0250249 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 54.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS