3-Amino-5-bromopicolinamide - CAS 669066-89-1
Catalog: |
BB033134 |
Product Name: |
3-Amino-5-bromopicolinamide |
CAS: |
669066-89-1 |
Synonyms: |
3-amino-5-bromopyridine-2-carboxamide |
IUPAC Name: | 3-amino-5-bromopyridine-2-carboxamide |
Description: | 3-Amino-5-bromopicolinamide (CAS# 669066-89-1) is a useful research chemical. |
Molecular Weight: | 216.04 |
Molecular Formula: | C6H6BrN3O |
Canonical SMILES: | C1=C(C(=NC=C1Br)C(=O)N)N |
InChI: | InChI=1S/C6H6BrN3O/c7-3-1-4(8)5(6(9)11)10-2-3/h1-2H,8H2,(H2,9,11) |
InChI Key: | VKYMXWCCSJWUQY-UHFFFAOYSA-N |
MDL: | MFCD11110235 |
LogP: | 1.80670 |
Publication Number | Title | Priority Date |
CN-214088354-U | Preparation system containing 3-amino-2-formamide pyridine structure compound | 20201204 |
US-2021094976-A1 | Pyrido[3,2-d]pyrimidine compounds as immunomodulators | 20190930 |
WO-2021067217-A1 | Pyrido[3,2-d]pyrimidine compounds as immunomodulators | 20190930 |
WO-2021047547-A1 | Novel tricyclic aromatic heterocyclic compound, preparation method therefor, pharmaceutical composition and application thereof | 20190909 |
WO-2020255038-A1 | Combination of hepatitis b virus (hbv) vaccines and pyridopyrimidine derivatives | 20190618 |
Complexity: | 164 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 214.96942 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 214.96942 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 82 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS