3-Amino-4,5-dihydro-1H-1-phenylpyrazole - CAS 3314-35-0
Catalog: |
BB021577 |
Product Name: |
3-Amino-4,5-dihydro-1H-1-phenylpyrazole |
CAS: |
3314-35-0 |
Synonyms: |
2-phenyl-3,4-dihydropyrazol-5-amine |
IUPAC Name: | 2-phenyl-3,4-dihydropyrazol-5-amine |
Description: | 3-Amino-4,5-dihydro-1H-1-phenylpyrazole (CAS# 3314-35-0) is a useful research chemical. |
Molecular Weight: | 161.20 |
Molecular Formula: | C9H11N3 |
Canonical SMILES: | C1CN(N=C1N)C2=CC=CC=C2 |
InChI: | InChI=1S/C9H11N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11) |
InChI Key: | QENUTIJJGGTTPE-UHFFFAOYSA-N |
Boiling Point: | 291.2 °C at 760 mmHg |
Melting Point: | 168-170 °C |
Purity: | 95 % |
Density: | 1.21 g/cm3 |
MDL: | MFCD00051730 |
LogP: | 1.36980 |
GHS Hazard Statement: | H302 (90.48%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P330, P337+P313, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-107796889-A | The different two functional group reagents derivatization of amino-pyrazol quinoline ketone and method for separating and analyzing of reproducibility sugar chain and glycoprotein O sugar chains | 20171013 |
CN-109563048-A | The method for being used to prepare 3- amino -1- (the disubstituted phenyl of 2,6-) pyrazoles | 20160815 |
KR-20190039177-A | Preparation of 3-amino-1- (2,6-dichlorophenyl) pyrazole | 20160815 |
AU-2012302723-A1 | Pyrazole compound and use thereof for medical purposes | 20110831 |
CA-2845127-A1 | Pyrazole compound and pharmaceutical use thereof for inhibiting sglt1 | 20110831 |
Complexity: | 182 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 161.095297364 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 161.095297364 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 41.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyrazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS