3-Amino-2-methyl-6-(trifluoromethyl)pyridine - CAS 383907-17-3
Catalog: |
BB023654 |
Product Name: |
3-Amino-2-methyl-6-(trifluoromethyl)pyridine |
CAS: |
383907-17-3 |
Synonyms: |
2-methyl-6-(trifluoromethyl)-3-pyridinamine; 2-methyl-6-(trifluoromethyl)pyridin-3-amine |
IUPAC Name: | 2-methyl-6-(trifluoromethyl)pyridin-3-amine |
Description: | 3-Amino-2-methyl-6-(trifluoromethyl)pyridine (CAS# 383907-17-3) is a useful research chemical. |
Molecular Weight: | 176.14 |
Molecular Formula: | C7H7F3N2 |
Canonical SMILES: | CC1=C(C=CC(=N1)C(F)(F)F)N |
InChI: | InChI=1S/C7H7F3N2/c1-4-5(11)2-3-6(12-4)7(8,9)10/h2-3H,11H2,1H3 |
InChI Key: | FUJKUIAVFVGTGS-UHFFFAOYSA-N |
Boiling Point: | 222 ℃ |
Density: | 1.307 g/cm3 |
MDL: | MFCD01311991 |
LogP: | 2.57220 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021021761-A1 | Urea, amide, and substituted heteroaryl compounds for cbl-b inhibition | 20190730 |
JP-2020111539-A | Fused heterocyclic compound and pest control agent | 20190111 |
WO-2020009653-A1 | Novel bronchodilating hetero-linked amides | 20180706 |
CN-112437771-A | Novel bronchodilator heteroatom-linked amides | 20180706 |
KR-20210032315-A | Novel bronchodilated heterolinked amide | 20180706 |
Complexity: | 157 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 176.05613272 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 176.05613272 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS