3-Amino-2-iodobenzoic acid - CAS 85600-30-2
Catalog: |
BB037660 |
Product Name: |
3-Amino-2-iodobenzoic acid |
CAS: |
85600-30-2 |
Synonyms: |
3-amino-2-iodobenzoic acid |
IUPAC Name: | 3-amino-2-iodobenzoic acid |
Description: | 3-Amino-2-iodobenzoic acid (CAS# 85600-30-2 ) is a useful research chemical. |
Molecular Weight: | 263.03 |
Molecular Formula: | C7H6INO2 |
Canonical SMILES: | C1=CC(=C(C(=C1)N)I)C(=O)O |
InChI: | InChI=1S/C7H6INO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,9H2,(H,10,11) |
InChI Key: | HEVQSUKLJWYDJR-UHFFFAOYSA-N |
LogP: | 2.15280 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P316, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-105431780-A | Resist underlayer film forming composition containing polymer which contains nitrogen-containing ring compound | 20130808 |
TW-201518867-A | Resist underlayer film forming composition containing polymer having cyclic compound having nitrogen | 20130808 |
TW-I628515-B | Resist underlayer film forming composition containing polymer having cyclic compound having nitrogen | 20130808 |
CN-104640929-A | Polyarylene sulfide resin composition and formed article | 20120919 |
CN-101506736-A | Resist underlayer film forming composition containing liquid additive | 20060828 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 262.94433 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 262.94433 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 63.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS