3,6-Dichloro-4-methoxypyridazine - CAS 70952-62-4
Catalog: |
BB034273 |
Product Name: |
3,6-Dichloro-4-methoxypyridazine |
CAS: |
70952-62-4 |
Synonyms: |
3,6-dichloro-4-methoxypyridazine; 3,6-dichloro-4-methoxypyridazine |
IUPAC Name: | 3,6-dichloro-4-methoxypyridazine |
Description: | 3,6-Dichloro-4-methoxypyridazine (CAS# 70952-62-4) is a useful research chemical. |
Molecular Weight: | 179.00 |
Molecular Formula: | C5H4Cl2N2O |
Canonical SMILES: | COC1=CC(=NN=C1Cl)Cl |
InChI: | InChI=1S/C5H4Cl2N2O/c1-10-3-2-4(6)8-9-5(3)7/h2H,1H3 |
InChI Key: | ODKKBTJZLBPUGU-UHFFFAOYSA-N |
MDL: | MFCD00477252 |
LogP: | 1.79200 |
Publication Number | Title | Priority Date |
CN-112979655-A | Triazolopyridazine derivative, preparation method, pharmaceutical composition and application thereof | 20191216 |
WO-2021121294-A1 | Triazolopyridazine derivative, preparation method therefor, pharmaceutical composition thereof, and use thereof | 20191216 |
WO-2021119254-A1 | Antagonists of the muscarinic acetylcholine receptor m4 | 20191210 |
WO-2020232401-A1 | Combination therapies with ire1 small molecule inhibitors | 20190515 |
WO-2020232403-A1 | Treatment of fibrosis with ire1 small molecule inhibitors | 20190515 |
Complexity: | 114 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 177.9700681 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 177.9700681 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridazines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS