3-(5-Fluoro-3-indolyl)-1-propanamine - CAS 245762-27-0
Catalog: |
BB018531 |
Product Name: |
3-(5-Fluoro-3-indolyl)-1-propanamine |
CAS: |
245762-27-0 |
Synonyms: |
3-(5-fluoro-1H-indol-3-yl)-1-propanamine; 3-(5-fluoro-1H-indol-3-yl)propan-1-amine |
IUPAC Name: | 3-(5-fluoro-1H-indol-3-yl)propan-1-amine |
Description: | 3-(5-Fluoro-3-indolyl)-1-propanamine (CAS# 245762-27-0) is a useful research chemical. |
Molecular Weight: | 192.23 |
Molecular Formula: | C11H13FN2 |
Canonical SMILES: | C1=CC2=C(C=C1F)C(=CN2)CCCN |
InChI: | InChI=1S/C11H13FN2/c12-9-3-4-11-10(6-9)8(7-14-11)2-1-5-13/h3-4,6-7,14H,1-2,5,13H2 |
InChI Key: | JBFFCANWDYAYFN-UHFFFAOYSA-N |
LogP: | 2.89860 |
Publication Number | Title | Priority Date |
AU-2010251930-A1 | 3-alkyl-5-fluoroindole derivatives as myeloperoxidase inhibitors | 20090527 |
JP-2012528120-A | Myeloperoxidase-inhibited 3-alkyl-5-fluoroindole derivatives | 20090527 |
US-2012122948-A1 | 3-alkyl-5-fluoroindole derivatives as myeloperoxidase inhibitors | 20090527 |
AU-2004261649-A1 | 3-amino choman and 2-amino tetralin derivatives | 20030730 |
CA-2533363-A1 | 3-amino choman and 2-amino tetralin derivatives | 20030730 |
PMID | Publication Date | Title | Journal |
21090682 | 20101223 | Structure-based design, synthesis, and pharmacological evaluation of 3-(aminoalkyl)-5-fluoroindoles as myeloperoxidase inhibitors | Journal of medicinal chemistry |
Complexity: | 186 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 192.10627659 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 192.10627659 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 41.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS