3,5-Dimethylphenylhydrazine Hydrochloride - CAS 60481-36-9
Catalog: |
BB030702 |
Product Name: |
3,5-Dimethylphenylhydrazine Hydrochloride |
CAS: |
60481-36-9 |
Synonyms: |
(3,5-dimethylphenyl)hydrazine;hydrochloride; (3,5-dimethylphenyl)hydrazine;hydrochloride |
IUPAC Name: | (3,5-dimethylphenyl)hydrazine;hydrochloride |
Description: | 3,5-Dimethylphenylhydrazine Hydrochloride (CAS# 60481-36-9) is a useful research chemical. |
Molecular Weight: | 172.66 |
Molecular Formula: | C8H13ClN2 |
Canonical SMILES: | CC1=CC(=CC(=C1)NN)C.Cl |
InChI: | InChI=1S/C8H12N2.ClH/c1-6-3-7(2)5-8(4-6)10-9;/h3-5,10H,9H2,1-2H3;1H |
InChI Key: | RSBQANBNDXZFIY-UHFFFAOYSA-N |
Boiling Point: | 247.3 ℃ at 760 mmHg |
MDL: | MFCD00052269 |
LogP: | 3.16430 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3517538-A1 | Pyrazolopyridine derivative having glp-1 receptor agonist effect | 20160926 |
US-2019225604-A1 | Pyrazolopyridine derivative having glp-1 receptor agonist effect | 20160926 |
US-10858356-B2 | Pyrazolopyridine derivative having GLP-1 receptor agonist effect | 20160926 |
US-2021017176-A1 | Pyrazolopyridine derivative having glp-1 receptor agonist effect | 20160926 |
US-2017044100-A1 | Inhibitors of drug-resistant mycobacterium tuberculosis | 20140422 |
Complexity: | 93.4 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 172.0767261 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 172.0767261 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 38 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS