3,5-Dimethyl-1-piperidyl Phenyl Ketone - CAS 121882-68-6
Catalog: |
BB005287 |
Product Name: |
3,5-Dimethyl-1-piperidyl Phenyl Ketone |
CAS: |
121882-68-6 |
Synonyms: |
(3,5-dimethyl-1-piperidinyl)-phenylmethanone; (3,5-dimethylpiperidin-1-yl)-phenylmethanone |
IUPAC Name: | (3,5-dimethylpiperidin-1-yl)-phenylmethanone |
Description: | 3,5-Dimethyl-1-piperidyl Phenyl Ketone (CAS# 121882-68-6 ) is a useful research chemical. |
Molecular Weight: | 217.31 |
Molecular Formula: | C14H19NO |
Canonical SMILES: | CC1CC(CN(C1)C(=O)C2=CC=CC=C2)C |
InChI: | InChI=1S/C14H19NO/c1-11-8-12(2)10-15(9-11)14(16)13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3 |
InChI Key: | ZIYABAITZZCZFQ-UHFFFAOYSA-N |
LogP: | 2.74260 |
Publication Number | Title | Priority Date |
WO-2019232245-A1 | A method for fluorinated ring-opening of a substrate | 20180601 |
EP-2535059-A1 | Use of compound binding to msin3b that specifically binds to neuron restrictive silencer factor (nrsf) | 20100210 |
JP-5850321-B2 | Use of a compound that binds to mSin3B that specifically binds to the nerve selective transcription repressor NRSF | 20100210 |
JP-WO2011099502-A1 | Use of a compound that binds to mSin3B that specifically binds to the nerve selective transcription repressor NRSF | 20100210 |
US-2013203738-A1 | Use of compound binding to msin3b that specifically binds to neuron restrictive silencer factor (nrsf) | 20100210 |
Complexity: | 235 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 217.14666423 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 217.14666423 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 20.3 |
Undefined Atom Stereocenter Count: | 2 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS