3,5-Dichloro-4-pyridinecarboxaldehyde - CAS 136590-83-5
Catalog: |
BB008378 |
Product Name: |
3,5-Dichloro-4-pyridinecarboxaldehyde |
CAS: |
136590-83-5 |
Synonyms: |
3,5-dichloropyridine-4-carbaldehyde |
IUPAC Name: | 3,5-dichloropyridine-4-carbaldehyde |
Description: | 3,5-Dichloro-4-pyridinecarboxaldehyde (CAS# 136590-83-5) is a useful research chemical compound. |
Molecular Weight: | 176.00 |
Molecular Formula: | C6H3Cl2NO |
Canonical SMILES: | C1=C(C(=C(C=N1)Cl)C=O)Cl |
InChI: | InChI=1S/C6H3Cl2NO/c7-5-1-9-2-6(8)4(5)3-10/h1-3H |
InChI Key: | RBFNWOINNIOZKR-UHFFFAOYSA-N |
Boiling Point: | 242.4 ℃ at 760 mmHg |
Melting Point: | 75-79 ℃ (lit.) |
Purity: | 95 % |
Density: | 1.488 g/cm3 |
Appearance: | White to brown solid, powder or crystals |
MDL: | MFCD04039921 |
LogP: | 2.20090 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021115495-A1 | Small-molecule sulfur-containing heterocyclic compound | 20191212 |
WO-2021069721-A1 | Atf6 modulators and uses thereof | 20191009 |
AU-2018357878-A1 | Spirocyclic compounds as farnesoid X receptor modulators | 20171101 |
AU-2018360575-A1 | Alkene spirocyclic compounds as farnesoid X receptor modulators | 20171101 |
CA-3080893-A1 | Alkene spirocyclic compounds as farnesoid x receptor modulators | 20171101 |
Complexity: | 121 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.9591691 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.9591691 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 30 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS