3,5-Dichloro-4-methoxybenzaldehyde - CAS 41727-58-6
Catalog: |
BB024941 |
Product Name: |
3,5-Dichloro-4-methoxybenzaldehyde |
CAS: |
41727-58-6 |
Synonyms: |
3,5-dichloro-4-methoxybenzaldehyde; 3,5-dichloro-4-methoxybenzaldehyde |
IUPAC Name: | 3,5-dichloro-4-methoxybenzaldehyde |
Description: | 3,5-Dichloro-4-methoxybenzaldehyde (CAS# 41727-58-6) is a useful research chemical. |
Molecular Weight: | 205.04 |
Molecular Formula: | C8H6Cl2O2 |
Canonical SMILES: | COC1=C(C=C(C=C1Cl)C=O)Cl |
InChI: | InChI=1S/C8H6Cl2O2/c1-12-8-6(9)2-5(4-11)3-7(8)10/h2-4H,1H3 |
InChI Key: | LEEKELDJRCUBEM-UHFFFAOYSA-N |
Boiling Point: | 328.9 °C at 760 mmHg |
Density: | 1.474 g/cm3 |
MDL: | MFCD04070684 |
LogP: | 2.70020 |
Publication Number | Title | Priority Date |
WO-2021108023-A1 | Penicillin-binding protein inhibitors | 20191126 |
CA-2799653-A1 | Substituted isoquinolines and their use as tubulin polymerization inhibitors | 20100604 |
EP-2576514-A1 | Substituted isoquinolines and their use as tubulin polymerization inhibitors | 20100604 |
US-2013131018-A1 | Substituted isoquinolines and their use as tubulin polymerization inhibitors | 20100604 |
WO-2011151423-A1 | Substituted isoquinolines and their use as tubulin polymerization inhibitors | 20100604 |
Complexity: | 151 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 203.9744848 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 203.9744848 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS