3,5-Dichloro-4-iodopyridine - CAS 343781-41-9
Catalog: |
BB022098 |
Product Name: |
3,5-Dichloro-4-iodopyridine |
CAS: |
343781-41-9 |
Synonyms: |
3,5-dichloro-4-iodopyridine |
IUPAC Name: | 3,5-dichloro-4-iodopyridine |
Description: | 3,5-Dichloro-4-iodopyridine (CAS# 343781-41-9 ) is a useful research chemical. |
Molecular Weight: | 273.89 |
Molecular Formula: | C5H2Cl2IN |
Canonical SMILES: | C1=C(C(=C(C=N1)Cl)I)Cl |
InChI: | InChI=1S/C5H2Cl2IN/c6-3-1-9-2-4(7)5(3)8/h1-2H |
InChI Key: | DEXLTMBFLWCGNF-UHFFFAOYSA-N |
Boiling Point: | 271.6 ℃ at 760 mmHg |
Melting Point: | 186-190 ℃(lit.) |
Purity: | 95 % |
Density: | 2.129 g/cm3 |
Appearance: | Tan to orange solid |
MDL: | MFCD03094687 |
LogP: | 2.99300 |
GHS Hazard Statement: | H302 (97.44%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021070957-A1 | Benzene condensed ring compound and medical composition containing same | 20191009 |
EP-3632910-A1 | Lactam compound as fxr receptor agonist | 20170526 |
WO-2017040766-A1 | Anti-viral tetrahydrofurane derivatives | 20150902 |
EP-3333157-B1 | Vinyl compounds as fgfr and vegfr inhibitors | 20150807 |
AU-2016255424-A1 | Benzimidazolone and benzothiazolone compounds and their use as AMPA receptor modulators | 20150429 |
Complexity: | 91 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 272.86090 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 272.86090 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS