3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyridine - CAS 15328-03-7
Catalog: |
BB010875 |
Product Name: |
3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyridine |
CAS: |
15328-03-7 |
Synonyms: |
5-(chloromethyl)-3-pyridin-3-yl-1,2,4-oxadiazole |
IUPAC Name: | 5-(chloromethyl)-3-pyridin-3-yl-1,2,4-oxadiazole |
Description: | 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyridine (CAS# 15328-03-7) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 195.61 |
Molecular Formula: | C8H6ClN3O |
Canonical SMILES: | C1=CC(=CN=C1)C2=NOC(=N2)CCl |
InChI: | InChI=1S/C8H6ClN3O/c9-4-7-11-8(12-13-7)6-2-1-3-10-5-6/h1-3,5H,4H2 |
InChI Key: | RGRRKYQLLSVYGV-UHFFFAOYSA-N |
Boiling Point: | 350.3 ℃ at 760 mmHg |
Density: | 1.35 g/cm3 |
Appearance: | Off-white solid |
MDL: | MFCD00264506 |
LogP: | 1.87040 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P310, P330, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2015191439-A1 | Inhibitors targeting drug-resistant influenza a | 20111206 |
US-9884832-B2 | Inhibitors targeting drug-resistant influenza A | 20111206 |
WO-2013086131-A1 | Inhibitors targeting drug-resistant influenza a | 20111206 |
US-10662180-B2 | Proteasome chymotrypsin-like inhibition using PI-1833 analogs | 20110324 |
US-2014073650-A1 | Proteasome chymotrypsin-like inhibition using pi-1833 analogs | 20110324 |
Complexity: | 170 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.0199395 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.0199395 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 51.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS