3,5-Bis(trifluoromethyl)benzenesulfonyl chloride - CAS 39234-86-1
Catalog: |
BB023908 |
Product Name: |
3,5-Bis(trifluoromethyl)benzenesulfonyl chloride |
CAS: |
39234-86-1 |
Synonyms: |
3,5-bis(trifluoromethyl)benzenesulfonyl chloride |
IUPAC Name: | 3,5-bis(trifluoromethyl)benzenesulfonyl chloride |
Description: | 3,5-Bis(trifluoromethyl)benzenesulfonyl chloride (CAS# 39234-86-1) is a useful research chemical. |
Molecular Weight: | 312.62 |
Molecular Formula: | C8H3ClF6O2S |
Canonical SMILES: | C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)Cl)C(F)(F)F |
InChI: | InChI=1S/C8H3ClF6O2S/c9-18(16,17)6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
InChI Key: | BTRCVKADYDVSLI-UHFFFAOYSA-N |
Boiling Point: | 70 ℃ / 2 mmHg |
Melting Point: | 35-36 ℃ |
Purity: | 95 % |
Density: | 1.618 g/cm3 |
Appearance: | White to yellow solid |
Storage: | Refrigerator |
MDL: | MFCD00014725 |
LogP: | 4.73250 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021165346-A1 | Gcn2 modulator compounds | 20200217 |
JP-2021121583-A | New sulfonamide derivative | 20200131 |
CN-112015050-A | Photoresist pattern trimming composition and pattern forming method | 20190531 |
JP-2020197709-A | Photoresist pattern trimming composition and pattern forming method | 20190531 |
KR-20200138024-A | Photoresist pattern trimming compositions and pattern formation methods | 20190531 |
Complexity: | 373 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 311.9446472 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 311.9446472 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS