3-(4-Methoxyphenoxy)-1-propanesulfonyl chloride - CAS 118943-25-2
Catalog: |
BB004350 |
Product Name: |
3-(4-Methoxyphenoxy)-1-propanesulfonyl chloride |
CAS: |
118943-25-2 |
Synonyms: |
3-(4-methoxyphenoxy)propane-1-sulfonyl chloride |
IUPAC Name: | 3-(4-methoxyphenoxy)propane-1-sulfonyl chloride |
Description: | 3-(4-Methoxyphenoxy)-1-propanesulfonyl chloride (CAS# 118943-25-2) is a useful research chemical. |
Molecular Weight: | 264.73 |
Molecular Formula: | C10H13ClO4S |
Canonical SMILES: | COC1=CC=C(C=C1)OCCCS(=O)(=O)Cl |
InChI: | InChI=1S/C10H13ClO4S/c1-14-9-3-5-10(6-4-9)15-7-2-8-16(11,12)13/h3-6H,2,7-8H2,1H3 |
InChI Key: | UFZBQBXKJZWBBV-UHFFFAOYSA-N |
Boiling Point: | 389.4 ℃ at 760 mmHg |
Melting Point: | 45-46.7 ℃ (lit.) |
Purity: | 95 % |
Density: | 1.304 g/cm3 |
MDL: | MFCD04039947 |
LogP: | 3.11350 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
AU-2011328904-A1 | Agonists that enhance binding of integrin-expressing cells to integrin receptors | 20101116 |
AU-2017201804-A1 | Agonists that enhance binding of integrin-expressing cells to integrin receptors | 20101116 |
AU-2017201804-B2 | Agonists that enhance binding of integrin-expressing cells to integrin receptors | 20101116 |
AU-2018236756-A1 | Agonists that enhance binding of integrin-expressing cells to integrin receptors | 20101116 |
AU-2018236756-B2 | Agonists that enhance binding of integrin-expressing cells to integrin receptors | 20101116 |
Complexity: | 278 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 264.0223078 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 264.0223078 |
Rotatable Bond Count: | 6 |
Topological Polar Surface Area: | 61 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS