3,4-Dihydrobenzo[f][1,4]oxazepin-5(2H)-one - CAS 703-51-5
Catalog: |
BB034137 |
Product Name: |
3,4-Dihydrobenzo[f][1,4]oxazepin-5(2H)-one |
CAS: |
703-51-5 |
Synonyms: |
3,4-dihydro-2H-1,4-benzoxazepin-5-one; 3,4-dihydro-2H-1,4-benzoxazepin-5-one |
IUPAC Name: | 3,4-dihydro-2H-1,4-benzoxazepin-5-one |
Description: | 3,4-Dihydrobenzo[f][1,4]oxazepin-5(2H)-one (CAS# 703-51-5) is a compound useful in organic synthesis. |
Molecular Weight: | 163.17 |
Molecular Formula: | C9H9NO2 |
Canonical SMILES: | C1COC2=CC=CC=C2C(=O)N1 |
InChI: | InChI=1S/C9H9NO2/c11-9-7-3-1-2-4-8(7)12-6-5-10-9/h1-4H,5-6H2,(H,10,11) |
InChI Key: | FGKQHXRVPDLTDF-UHFFFAOYSA-N |
Boiling Point: | 404.7 °C at 760 mmHg |
Density: | 1.186 g/cm3 |
MDL: | MFCD02726416 |
LogP: | 1.13760 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
KR-20210039968-A | Bicyclic compound and use thereof | 20191002 |
US-2021101892-A1 | Bicyclic compound and use thereof | 20191002 |
WO-2021066578-A1 | Bicyclic compound and use thereof | 20191002 |
KR-20210039666-A | Bicyclic compound and use thereof | 20191002 |
US-11111237-B2 | Bicyclic compound and use thereof | 20191002 |
Complexity: | 181 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 163.063328530 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 163.063328530 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS