3,4-Dichloro-5-phenylfuran-2(5H)-one - CAS 72857-85-3
Catalog: |
BB034711 |
Product Name: |
3,4-Dichloro-5-phenylfuran-2(5H)-one |
CAS: |
72857-85-3 |
Synonyms: |
3,4-dichloro-2-phenyl-2H-furan-5-one; 3,4-dichloro-2-phenyl-2H-furan-5-one |
IUPAC Name: | 3,4-dichloro-2-phenyl-2H-furan-5-one |
Description: | 3,4-Dichloro-5-phenylfuran-2(5H)-one (CAS# 72857-85-3) is a useful research chemical compound. |
Molecular Weight: | 229.06 |
Molecular Formula: | C10H6Cl2O2 |
Canonical SMILES: | C1=CC=C(C=C1)C2C(=C(C(=O)O2)Cl)Cl |
InChI: | InChI=1S/C10H6Cl2O2/c11-7-8(12)10(13)14-9(7)6-4-2-1-3-5-6/h1-5,9H |
InChI Key: | DCZUHULHKRPPLT-UHFFFAOYSA-N |
LogP: | 2.97370 |
Publication Number | Title | Priority Date |
CA-2969786-A1 | Compositions and methods for enhancing oncolytic virus efficacy | 20150126 |
CA-2970954-A1 | Compositions and methods for viral sensitization | 20150126 |
EP-3250550-A1 | Compositions and methods for viral sensitization | 20150126 |
US-10654839-B2 | Compositions and methods for viral sensitization | 20150126 |
US-2018112190-A1 | Compositions and methods for viral sensitization | 20150126 |
Complexity: | 280 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 227.9744848 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 227.9744848 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS