3,4-Dichloro-3-cyclobutene-1,2-dione - CAS 2892-63-9
Catalog: |
BB020016 |
Product Name: |
3,4-Dichloro-3-cyclobutene-1,2-dione |
CAS: |
2892-63-9 |
Synonyms: |
3,4-dichlorocyclobut-3-ene-1,2-dione; 3,4-dichlorocyclobut-3-ene-1,2-dione |
IUPAC Name: | 3,4-dichlorocyclobut-3-ene-1,2-dione |
Description: | 3,4-Dichloro-3-cyclobutene-1,2-dione (CAS# 2892-63-9) is a useful research chemical. |
Molecular Weight: | 150.95 |
Molecular Formula: | C4Cl2O2 |
Canonical SMILES: | C1(=C(C(=O)C1=O)Cl)Cl |
InChI: | InChI=1S/C4Cl2O2/c5-1-2(6)4(8)3(1)7 |
InChI Key: | SXOQOOQUBDERIZ-UHFFFAOYSA-N |
Boiling Point: | 175.6 ℃ at 760 mmHg |
Density: | 1.74 g/cm3 |
MDL: | MFCD09763706 |
LogP: | 0.82740 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020208509-A1 | Novel oxadiazole compounds for controlling or preventing phytopathogenic fungi | 20190408 |
TW-202104197-A | Oxadiazole compounds, applications of the same and methods of producing the same | 20190408 |
EP-3636637-A1 | Inhibiting fatty acid synthase (fasn) | 20181010 |
US-2020115368-A1 | Inhibiting fatty acid synthase (fasn) | 20181010 |
US-10875848-B2 | Inhibiting fatty acid synthase (FASN) | 20181010 |
Complexity: | 182 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 149.9275346 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 149.9275346 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 34.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS