3,4-Dibromothiophene-2-carboxaldehyde - CAS 32896-02-9
Catalog: |
BB021474 |
Product Name: |
3,4-Dibromothiophene-2-carboxaldehyde |
CAS: |
32896-02-9 |
Synonyms: |
3,4-dibromothiophene-2-carbaldehyde |
IUPAC Name: | 3,4-dibromothiophene-2-carbaldehyde |
Description: | 3,4-Dibromothiophene-2-carboxaldehyde (CAS# 32896-02-9) is a useful research chemical. |
Molecular Weight: | 269.94 |
Molecular Formula: | C5H2Br2OS |
Canonical SMILES: | C1=C(C(=C(S1)C=O)Br)Br |
InChI: | InChI=1S/C5H2Br2OS/c6-3-2-9-4(1-8)5(3)7/h1-2H |
InChI Key: | QCCFUWPEUHXQMH-UHFFFAOYSA-N |
Appearance: | White to brown powder |
MDL: | MFCD08281875 |
LogP: | 3.08560 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]; H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
Precautionary Statement: | P264, P264+P265, P270, P280, P301+P316, P305+P351+P338, P321, P330, P337+P317, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021123237-A1 | 2-amino-n-(amino-oxo-aryl-lambda6-sulfanylidene)acetamide compounds and their therapeutic use | 20191219 |
WO-2020261144-A1 | 5-(thiophen-2-yl)-1h-tetrazole derivatives as bckdk inhibitors useful for treating various diseases | 20190628 |
CN-107011320-A | Cyclopropyl substituted thiophene cycloalkane amine compound and its application | 20170517 |
KR-20140059195-A | Tricyclic heterocyclic compounds and JAK inhibitors | 20110812 |
TW-201313837-A | Dyes, method of making them, and their use in dye sensitized solar cells | 20110617 |
Complexity: | 120 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 269.81726 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 267.81931 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 45.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS