3-(4-Cyanophenoxy)propionic Acid - CAS 58228-89-0
Catalog: |
BB029972 |
Product Name: |
3-(4-Cyanophenoxy)propionic Acid |
CAS: |
58228-89-0 |
Synonyms: |
3-(4-cyanophenoxy)propanoic acid; 3-(4-cyanophenoxy)propanoic acid |
IUPAC Name: | 3-(4-cyanophenoxy)propanoic acid |
Description: | 3-(4-Cyanophenoxy)propionic Acid (CAS# 58228-89-0) is a useful research chemical. |
Molecular Weight: | 191.18 |
Molecular Formula: | C10H9NO3 |
Canonical SMILES: | C1=CC(=CC=C1C#N)OCCC(=O)O |
InChI: | InChI=1S/C10H9NO3/c11-7-8-1-3-9(4-2-8)14-6-5-10(12)13/h1-4H,5-6H2,(H,12,13) |
InChI Key: | QKPRNTOVSOLJPN-UHFFFAOYSA-N |
Boiling Point: | 369.787 ℃ at 760 mmHg |
Density: | 1.273 g/cm3 |
LogP: | 1.41178 |
Publication Number | Title | Priority Date |
EP-3476829-A1 | Biaryl urea derivative or salt thereof, and manufacturing and application of same | 20160622 |
US-10647665-B2 | Biaryl urea derivative or salt thereof and preparation process and use for the same | 20160622 |
US-2019248737-A1 | Biaryl urea derivative or salt thereof and preparation process and use for the same | 20160622 |
US-10851050-B2 | Biaryl urea derivative or salt thereof and preparation process and use for the same | 20160622 |
US-2020239411-A1 | Biaryl urea derivative or salt thereof and preparation process and use for the same | 20160622 |
Complexity: | 235 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 191.058243149 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 191.058243149 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 70.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS