3-[(3-Fluorophenoxy)methyl]piperidine - CAS 405090-68-8
Catalog: |
BB024543 |
Product Name: |
3-[(3-Fluorophenoxy)methyl]piperidine |
CAS: |
405090-68-8 |
Synonyms: |
3-[(3-fluorophenoxy)methyl]piperidine |
IUPAC Name: | 3-[(3-fluorophenoxy)methyl]piperidine |
Description: | 3-[(3-Fluorophenoxy)methyl]piperidine (CAS# 405090-68-8) is a useful research chemical. |
Molecular Weight: | 209.26 |
Molecular Formula: | C12H16FNO |
Canonical SMILES: | C1CC(CNC1)COC2=CC(=CC=C2)F |
InChI: | InChI=1S/C12H16FNO/c13-11-4-1-5-12(7-11)15-9-10-3-2-6-14-8-10/h1,4-5,7,10,14H,2-3,6,8-9H2 |
InChI Key: | DFSSBGQXURBSLS-UHFFFAOYSA-N |
Boiling Point: | 288.6 °C at 760 mmHg |
Purity: | 95 % |
Density: | 1.066 g/cm3 |
LogP: | 2.53290 |
Publication Number | Title | Priority Date |
CN-106029648-A | Substituted bipiperidinyl derivatives as adrenoreceptor alpha 2C antagonists | 20131219 |
US-2016318866-A1 | Substituted bipiperidinyl derivatives | 20131219 |
WO-2015091415-A1 | Substituted bipiperidinyl derivatives as adrenoreceptor alpha 2c antagonists | 20131219 |
CA-2879256-A1 | Substituted carbamate compounds and their use as transient receptor potential (trp) channel antagonists | 20121016 |
CN-104703970-A | Substituted carbamate compounds and their use as transient receptor potential (TRP) channel antagonists | 20121016 |
Complexity: | 189 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 209.121592296 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 209.121592296 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 21.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Fluorinated Building Blocks
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS