3,3-Dimethyl-1-oxoisoindoline-5-carbonitrile - CAS 1440519-98-1
Catalog: |
BB009716 |
Product Name: |
3,3-Dimethyl-1-oxoisoindoline-5-carbonitrile |
CAS: |
1440519-98-1 |
Synonyms: |
3,3-dimethyl-1-oxo-2H-isoindole-5-carbonitrile; 3,3-dimethyl-1-oxo-2H-isoindole-5-carbonitrile |
IUPAC Name: | 3,3-dimethyl-1-oxo-2H-isoindole-5-carbonitrile |
Description: | 3,3-Dimethyl-1-oxoisoindoline-5-carbonitrile (CAS# 1440519-98-1 ) is a useful research chemical. |
Molecular Weight: | 186.21 |
Molecular Formula: | C11H10N2O |
Canonical SMILES: | CC1(C2=C(C=CC(=C2)C#N)C(=O)N1)C |
InChI: | InChI=1S/C11H10N2O/c1-11(2)9-5-7(6-12)3-4-8(9)10(14)13-11/h3-5H,1-2H3,(H,13,14) |
InChI Key: | ODITXVOCXCXIOY-UHFFFAOYSA-N |
LogP: | 1.86558 |
Publication Number | Title | Priority Date |
AU-2015330141-A1 | Spirodiamine derivatives as aldosterone synthase inhibitors | 20141008 |
AU-2015330141-B2 | Spirodiamine derivatives as aldosterone synthase inhibitors | 20141008 |
CA-2962122-A1 | Spirodiamine derivatives as aldosterone synthase inhibitors | 20141008 |
CN-106852142-A | As the spiral shell diamine derivative of aldosterone synthase inhibitors | 20141008 |
EP-3204383-A1 | Spirodiamine derivatives as aldosterone synthase inhibitors | 20141008 |
Complexity: | 313 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.079312947 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.079312947 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 52.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS