3-(3,5-Dibromophenyl)propionic acid - CAS 923977-15-5
Catalog: |
BB040504 |
Product Name: |
3-(3,5-Dibromophenyl)propionic acid |
CAS: |
923977-15-5 |
Synonyms: |
3-(3,5-dibromophenyl)propanoic acid |
IUPAC Name: | 3-(3,5-dibromophenyl)propanoic acid |
Description: | 3-(3,5-Dibromophenyl)propionic acid (CAS# 923977-15-5) is used a reactant in the coupling of supramolecular exo-functionalized palladium cages to peptides for biomedical applications. |
Molecular Weight: | 307.97 |
Molecular Formula: | C9H8Br2O2 |
Canonical SMILES: | C1=C(C=C(C=C1Br)Br)CCC(=O)O |
InChI: | InChI=1S/C9H8Br2O2/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h3-5H,1-2H2,(H,12,13) |
InChI Key: | AMKWPMUHANVQSZ-UHFFFAOYSA-N |
LogP: | 3.22880 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P310, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
JP-2019532021-A | Cyclic peptides as C5a receptor antagonists | 20160729 |
AU-2016381336-A1 | Meta-azacyclic amino benzoic acid derivatives as pan integrin antagonists | 20151230 |
AU-2015345943-A1 | Substituted aromatic compounds and pharmaceutical compositions for tissue self-repair and regeneration | 20141112 |
AU-2015345943-B2 | Substituted aromatic compounds and pharmaceutical compositions for tissue self-repair and regeneration | 20141112 |
CA-2967499-A1 | Substituted aromatic compounds and pharmaceutical compositions for tissue self-repair and regeneration | 20141112 |
Complexity: | 175 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 307.88706 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 305.88910 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 37.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS