3-(2-Fluorophenyl)cyclobutanone - CAS 1080636-31-2
Catalog: |
BB002164 |
Product Name: |
3-(2-Fluorophenyl)cyclobutanone |
CAS: |
1080636-31-2 |
Synonyms: |
3-(2-fluorophenyl)-1-cyclobutanone; 3-(2-fluorophenyl)cyclobutan-1-one |
IUPAC Name: | 3-(2-fluorophenyl)cyclobutan-1-one |
Description: | 3-(2-Fluorophenyl)cyclobutanone (CAS# 1080636-31-2) is a useful research chemical. |
Molecular Weight: | 164.18 |
Molecular Formula: | C10H9FO |
Canonical SMILES: | C1C(CC1=O)C2=CC=CC=C2F |
InChI: | InChI=1S/C10H9FO/c11-10-4-2-1-3-9(10)7-5-8(12)6-7/h1-4,7H,5-6H2 |
InChI Key: | ZNHOEHONJNYTDA-UHFFFAOYSA-N |
MDL: | MFCD11848521 |
LogP: | 2.27220 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2008249745-A1 | Substituted heterocyclic derivatives and compositions and their pharmaceutical use as antibacterials | 20070509 |
AU-2008249745-B2 | Substituted heterocyclic derivatives and compositions and their pharmaceutical use as antibacterials | 20070509 |
CN-101679357-A | Substituted heterocyclic derivatives and their pharmaceutical use and compositions | 20070509 |
EP-2155716-A2 | Substituted heterocyclic derivatives and compositions and their pharmaceutical use as antibacterials | 20070509 |
EP-2481735-A1 | Substituted heterocyclic derivatives and compositions and their pharmaceutical use as antibacterials | 20070509 |
Complexity: | 182 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 164.063743068 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 164.063743068 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS