[(2S)-2-Methylpyrrolidin-2-yl]methanol hydrochloride - CAS 115512-58-8
Catalog: |
BB057843 |
Product Name: |
[(2S)-2-Methylpyrrolidin-2-yl]methanol hydrochloride |
CAS: |
115512-58-8 |
Synonyms: |
2-Pyrrolidinemethanol, 2-methyl-, (S)-; [(2S)-2-methylpyrrolidin-2-yl]methanol; (2S)-2-Methylpyrrolidine-2-methanol; 2-Methylpyrrolidine-2alpha-methanol; (2-Methyl-2-pyrrolidinyl)methanol # |
IUPAC Name: | [(2S)-2-methylpyrrolidin-2-yl]methanol |
Description: | [(2S)-2-Methylpyrrolidin-2-yl]methanol hydrochloride (CAS# 115512-58-8) is a useful research chemical compound. |
Molecular Weight: | 151.64 |
Molecular Formula: | C6H14ClNO |
Canonical SMILES: | CC1(CCCN1)CO |
InChI: | InChI=1S/C6H13NO/c1-6(5-8)3-2-4-7-6/h7-8H,2-5H2,1H3/t6-/m0/s1 |
InChI Key: | BJOWRJDUPYOCEU-LURJTMIESA-N |
GHS Hazard Statement: | H227 (100%): Combustible liquid [Warning Flammable liquids] |
Precautionary Statement: | P210, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P332+P317, P362+P364, P370+P378, P403, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021239058-A1 | Fused tricyclic compound, pharmaceutical composition thereof, and use thereof | 20200527 |
WO-2020146613-A1 | Kras g12c inhibitors | 20190110 |
EP-3735299-A2 | Fused ring compounds | 20181109 |
WO-2020047192-A1 | Kras g12c inhibitors | 20180831 |
EP-3710439-A1 | Kras g12c inhibitors | 20171115 |
WO-2019051465-A1 | RAD51 INHIBITORS | 20170911 |
EP-3681884-A1 | Rad51 inhibitors | 20170911 |
EP-3458445-A1 | Kras g12c inhibitors | 20160518 |
WO-2017201161-A1 | Kras g12c inhibitors | 20160518 |
WO-2015109109-A1 | Fused morpholinopyrimidines and methods of use thereof | 20140115 |
Complexity: | 84.6 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 115.099714038 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 115.099714038 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 32.3Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS