2-[(Trimethylsilyl)ethynyl]toluene - CAS 3989-15-9
Catalog: |
BB024187 |
Product Name: |
2-[(Trimethylsilyl)ethynyl]toluene |
CAS: |
3989-15-9 |
Synonyms: |
trimethyl-[2-(2-methylphenyl)ethynyl]silane |
IUPAC Name: | trimethyl-[2-(2-methylphenyl)ethynyl]silane |
Description: | 2-[(Trimethylsilyl)ethynyl]toluene (CAS# 3989-15-9 ) is a useful research chemical. |
Molecular Weight: | 188.34 |
Molecular Formula: | C12H16Si |
Canonical SMILES: | CC1=CC=CC=C1C#C[Si](C)(C)C |
InChI: | InChI=1S/C12H16Si/c1-11-7-5-6-8-12(11)9-10-13(2,3)4/h5-8H,1-4H3 |
InChI Key: | POJCCZAVVWWXNS-UHFFFAOYSA-N |
Boiling Point: | 50-60 °C / 0.5 mmHg (lit.) |
Density: | 0.880 g/cm3 |
Appearance: | Colorless to yellow liquid |
MDL: | MFCD03427240 |
LogP: | 3.22390 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020223672-A1 | Functionalized cyclic polymers and methods of preparing same | 20190501 |
CN-107459438-B | Novel practical nonmetal-catalyzed silica-based deprotection method | 20170701 |
CN-109311886-A | Novel [1,2,3] triazol [4,5-d] pyrimidine derivatives | 20160623 |
CN-109348716-A | There are [1,2,3] triazol [4,5-d] pyrimidine derivatives of affinity to 2 type Cannabined receptors | 20160623 |
WO-2010063487-A1 | Pyrazolopyrimidines, a process for their preparation and their use as medicine | 20081205 |
Complexity: | 223 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 188.102127045 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 188.102127045 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alkynes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS