2-(Trimethylsilyl)ethanesulfonic acid sodium salt - CAS 18143-40-3
Catalog: |
BB013814 |
Product Name: |
2-(Trimethylsilyl)ethanesulfonic acid sodium salt |
CAS: |
18143-40-3 |
Synonyms: |
sodium;2-trimethylsilylethanesulfonate |
IUPAC Name: | sodium;2-trimethylsilylethanesulfonate |
Description: | 2-(Trimethylsilyl)ethanesulfonic acid sodium salt (CAS# 18143-40-3) is a useful research chemical. |
Molecular Weight: | 206.31 |
Molecular Formula: | C5H13NaO3SSi |
Canonical SMILES: | C[Si](C)(C)CCS(=O)(=O)[O-].[Na+] |
InChI: | InChI=1S/C5H14O3SSi.Na/c1-10(2,3)5-4-9(6,7)8;/h4-5H2,1-3H3,(H,6,7,8);/q;+1/p-1 |
InChI Key: | ASHUMJJXIKNLAH-UHFFFAOYSA-M |
LogP: | 1.95060 |
Publication Number | Title | Priority Date |
US-2021000119-A1 | Synthesis and anti-cancer activity of communesin alkaloids | 20190701 |
EP-3565017-A1 | Electrochemical light emitting cell | 20161227 |
JP-WO2018124102-A1 | Electrochemiluminescence cell | 20161227 |
US-2019316738-A1 | Light-emitting electrochemical cell | 20161227 |
WO-2018124102-A1 | Electrochemical light emitting cell | 20161227 |
Complexity: | 189 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.02523626 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.02523626 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 65.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS