2-Oxaspiro[3.3]heptan-6-one - CAS 1339892-66-8
Catalog: |
BB007849 |
Product Name: |
2-Oxaspiro[3.3]heptan-6-one |
CAS: |
1339892-66-8 |
Synonyms: |
2-oxaspiro[3.3]heptan-6-one; 2-oxaspiro[3.3]heptan-6-one |
IUPAC Name: | 2-oxaspiro[3.3]heptan-6-one |
Description: | 2-Oxaspiro[3.3]heptan-6-one (CAS# 1339892-66-8) is a useful research chemical. |
Molecular Weight: | 112.13 |
Molecular Formula: | C6H8O2 |
Canonical SMILES: | C1C(=O)CC12COC2 |
InChI: | InChI=1S/C6H8O2/c7-5-1-6(2-5)3-8-4-6/h1-4H2 |
InChI Key: | JWNCVDJOXJTJPB-UHFFFAOYSA-N |
MDL: | MFCD22415239 |
LogP: | 0.36590 |
GHS Hazard Statement: | H227 (100%): Combustible liquid [Warning Flammable liquids] |
Precautionary Statement: | P210, P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P332+P313, P362, P370+P378, P403+P233, P403+P235, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021210857-A1 | 1,3,4-oxadiazole derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20200413 |
KR-20210108274-A | 1,3,4-Oxadiazole Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20200225 |
KR-20210108555-A | 1,3,4-Oxadiazol Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20200225 |
WO-2021172886-A1 | 1,3,4-oxadiazole derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20200225 |
WO-2021172887-A1 | 1,3,4-oxadiazole derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20200225 |
Complexity: | 126 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 112.052429494 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 112.052429494 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS