2-Nitrophenylacetylene - CAS 16433-96-8
Catalog: |
BB012101 |
Product Name: |
2-Nitrophenylacetylene |
CAS: |
16433-96-8 |
Synonyms: |
1-ethynyl-2-nitrobenzene; 1-ethynyl-2-nitrobenzene |
IUPAC Name: | 1-ethynyl-2-nitrobenzene |
Description: | 2-Nitrophenylacetylene (CAS# 16433-96-8) is a useful research chemical compound. |
Molecular Weight: | 147.13 |
Molecular Formula: | C8H5NO2 |
Canonical SMILES: | C#CC1=CC=CC=C1[N+](=O)[O-] |
InChI: | InChI=1S/C8H5NO2/c1-2-7-5-3-4-6-8(7)9(10)11/h1,3-6H |
InChI Key: | FWAGYANFBMIHFQ-UHFFFAOYSA-N |
Boiling Point: | 247.5 °C at 760 mmHg |
Density: | 1.22 g/cm3 |
MDL: | MFCD01113917 |
LogP: | 2.09930 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113363076-A | Overvoltage automatic short-circuit protection capacitor | 20210809 |
CN-113248455-A | 3, 5-disubstituted isoxazole derivatives and synthesis method thereof | 20210525 |
CN-113072560-A | Carbazole derivative and application thereof | 20210409 |
WO-2021083459-A1 | Process for the synthesis of dopa comprising a photolabile protective group, and intermediates for the preparation thereof | 20191029 |
US-10590091-B2 | Process for the preparation of azidoperfluoroalkanes and N-polyfluoroalkyl azides | 20171130 |
PMID | Publication Date | Title | Journal |
18174991 | 20080121 | Diels-Alder approach to biaryls (DAB): importance of the ortho-nitro moiety in the [4 + 2] cycloaddition | Organic & biomolecular chemistry |
17552534 | 20070705 | Efficient nucleophilic aromatic substitution between aryl nitrofluorides and alkynes | Organic letters |
15907135 | 20050530 | Synthesis, photophysics, and optical limiting of platinum(II) 4'-tolylterpyridyl arylacetylide complexes | Inorganic chemistry |
15074935 | 20040416 | Enantioselective total synthesis of FR900482 | The Journal of organic chemistry |
Complexity: | 198 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 147.032028402 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 147.032028402 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 45.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS