2-Methyl-1-naphthaldehyde - CAS 35699-44-6
Catalog: |
BB022730 |
Product Name: |
2-Methyl-1-naphthaldehyde |
CAS: |
35699-44-6 |
Synonyms: |
2-methylnaphthalene-1-carbaldehyde |
IUPAC Name: | 2-methylnaphthalene-1-carbaldehyde |
Description: | 2-Methyl-1-naphthaldehyde (CAS# 35699-44-6) is a useful research chemical. |
Molecular Weight: | 170.21 |
Molecular Formula: | C12H10O |
Canonical SMILES: | CC1=C(C2=CC=CC=C2C=C1)C=O |
InChI: | InChI=1S/C12H10O/c1-9-6-7-10-4-2-3-5-11(10)12(9)8-13/h2-8H,1H3 |
InChI Key: | WIAZTPUQHUFMQA-UHFFFAOYSA-N |
Boiling Point: | 316.5 ℃ at 760 mmHg |
Density: | 1.123 g/cm3 |
MDL: | MFCD02261774 |
LogP: | 2.96070 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021117456-A1 | Treatment liquid and pattern forming method | 20191209 |
WO-2021106535-A1 | Active-ray-sensitive or radiation-sensitive resin composition, pattern formation method, and electronic device manufacturing method | 20191129 |
WO-2021070764-A1 | Negative-working photosensitive resin composition, photosensitive resist film, pattern formation method, cured film, cured film production method, and rolled body | 20191008 |
WO-2021065450-A1 | Active light sensitive or radiation sensitive resin composition, active light sensitive or radiation sensitive film, pattern forming method, and method for producing electronic device | 20190930 |
WO-2021065548-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, actinic ray-sensitive or radiation-sensitive film, pattern forming method, and electronic device manufacturing method | 20190930 |
PMID | Publication Date | Title | Journal |
21546175 | 20120210 | Identification of 1-butyl-3-(1-(4-methyl)naphthoyl)indole in a herbal mixture | Forensic science international |
Complexity: | 188 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 170.073164938 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 170.073164938 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS