2-Methyl-1,3-dioxolane-2-acetamide - CAS 70829-14-0
Catalog: |
BB034251 |
Product Name: |
2-Methyl-1,3-dioxolane-2-acetamide |
CAS: |
70829-14-0 |
Synonyms: |
2-(2-methyl-1,3-dioxolan-2-yl)acetamide; 2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
IUPAC Name: | 2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
Description: | 2-Methyl-1,3-dioxolane-2-acetamide (CAS# 70829-14-0 ) is a useful research chemical. |
Molecular Weight: | 145.16 |
Molecular Formula: | C6H11NO3 |
Canonical SMILES: | CC1(OCCO1)CC(=O)N |
InChI: | InChI=1S/C6H11NO3/c1-6(4-5(7)8)9-2-3-10-6/h2-4H2,1H3,(H2,7,8) |
InChI Key: | GBBSDGQCRVDMSD-UHFFFAOYSA-N |
LogP: | 0.77450 |
Publication Number | Title | Priority Date |
EP-3233841-A1 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
US-10323000-B2 | Indole derivatives and their use in neurodegenerative diseases | 20141215 |
US-10676433-B2 | Indole derivatives and their use in neurodegenerative diseases | 20141215 |
US-2016168090-A1 | Novel indole derivatives and their use in neurodegenerative diseases | 20141215 |
US-2019161447-A1 | Novel indole derivatives and their use in neurodegenerative diseases | 20141215 |
Complexity: | 140 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 145.07389321 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 145.07389321 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 61.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS