2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole - CAS 1312765-17-5
Catalog: |
BB060443 |
Product Name: |
2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
CAS: |
1312765-17-5 |
Synonyms: |
2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole |
IUPAC Name: | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
Description: | 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 241.12 |
Molecular Formula: | C10H16BNO3S |
Canonical SMILES: | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)OC |
InChI: | InChI=1S/C10H16BNO3S/c1-9(2)10(3,4)15-11(14-9)7-6-12-8(13-5)16-7/h6H,1-5H3 |
InChI Key: | NNPOTMMCXYMAPM-UHFFFAOYSA-N |
References: | Yoshikawa, K., et al. From PCT Int. Appl. (2020), WO 2020116662 A1 20200611; Wu, C., t al. From PCT Int. Appl. (2020), WO 2020038394 A1 20200227. |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020116662-A1 | Cycloalkane-1,3-diamine derivative | 20181206 |
TW-202039512-A | Cycloalkane-1,3-diamine compounds | 20181206 |
BR-112021007421-A2 | cycloalkane-1,3-diamine derivative | 20181206 |
CA-3116141-A1 | Cycloalkane-1,3-diamine derivative | 20181206 |
CN-113164481-A | Cycloalkane-1, 3-diamine derivatives | 20181206 |
EP-3892278-A1 | Cycloalkane-1,3-diamine derivative | 20181206 |
KR-20210100612-A | Cycloalkane-1,3-diamine derivatives | 20181206 |
US-2021269454-A1 | Cycloalkane-1,3-diamine derivative | 20181206 |
US-11236106-B2 | Cycloalkane-1,3-diamine derivative | 20181206 |
US-2020131132-A1 | Farnesoid x receptor agonists and uses thereof | 20170315 |
Complexity: | 259 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 241.0943947 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 241.0943947 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 68.8Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS