2-Methoxy-5-(3',7'-dimethyloctyloxy)terephthalaldehyde - CAS 207394-56-7
Catalog: |
BB016248 |
Product Name: |
2-Methoxy-5-(3',7'-dimethyloctyloxy)terephthalaldehyde |
CAS: |
207394-56-7 |
Synonyms: |
2-(3,7-dimethyloctoxy)-5-methoxyterephthalaldehyde |
IUPAC Name: | 2-(3,7-dimethyloctoxy)-5-methoxyterephthalaldehyde |
Description: | 2-Methoxy-5-(3',7'-dimethyloctyloxy)terephthalaldehyde (CAS# 207394-56-7 ) is a useful research chemical. |
Molecular Weight: | 320.42 |
Molecular Formula: | C19H28O4 |
Canonical SMILES: | CC(C)CCCC(C)CCOC1=CC(=C(C=C1C=O)OC)C=O |
InChI: | InChI=1S/C19H28O4/c1-14(2)6-5-7-15(3)8-9-23-19-11-16(12-20)18(22-4)10-17(19)13-21/h10-15H,5-9H2,1-4H3 |
InChI Key: | IPIUNLMDSXJBFQ-UHFFFAOYSA-N |
Melting Point: | 81.0-86.8 ℃(lit.) |
Purity: | 95 % |
MDL: | MFCD03427238 |
LogP: | 4.55150 |
Publication Number | Title | Priority Date |
DE-10318096-A1 | Process for molecular weight control in the synthesis of poly (arylenevinylenes) | 20030417 |
EP-1623471-A1 | Method for controlling the molecular weight during poly(arylene vinylene) synthesis, and polymers produced therewith | 20030417 |
EP-1623471-B1 | Method for controlling the molecular weight during poly(arylene vinylene) synthesis, and polymers produced therewith | 20030417 |
JP-2006523739-A | Method for the control of molecular weight during the synthesis of poly (arylene vinylene) and polymers produced thereby | 20030417 |
JP-4444952-B2 | Method for the control of molecular weight during the synthesis of poly (arylene vinylene) and polymers produced thereby | 20030417 |
Complexity: | 342 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 320.19875937 |
Formal Charge: | 0 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 320.19875937 |
Rotatable Bond Count: | 11 |
Topological Polar Surface Area: | 52.6 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS