2-Methoxy-4-methyl-5-nitropyridine - CAS 6635-90-1
Catalog: |
BB033003 |
Product Name: |
2-Methoxy-4-methyl-5-nitropyridine |
CAS: |
6635-90-1 |
Synonyms: |
2-methoxy-4-methyl-5-nitropyridine |
IUPAC Name: | 2-methoxy-4-methyl-5-nitropyridine |
Description: | 2-Methoxy-4-methyl-5-nitropyridine can be used to inhibit RNA heliCASe DHX33 to prevent and/or treat DHX33-related diseases, such as, cancer. |
Molecular Weight: | 168.15 |
Molecular Formula: | C7H8N2O3 |
Canonical SMILES: | CC1=CC(=NC=C1[N+](=O)[O-])OC |
InChI: | InChI=1S/C7H8N2O3/c1-5-3-7(12-2)8-4-6(5)9(10)11/h3-4H,1-2H3 |
InChI Key: | DJNQRLCFAHKFLZ-UHFFFAOYSA-N |
Boiling Point: | 280.3 ℃ at 760 mmHg |
Density: | 1.247 g/cm3 |
MDL: | MFCD03095075 |
LogP: | 1.83000 |
GHS Hazard Statement: | H302 (97.44%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112661754-A | Polycyclic compound for inhibiting RNA helicase DHX33 | 20201230 |
WO-2021062316-A1 | Azaindole carboxamide compounds for the treatment of mycobacterial infections | 20190926 |
WO-2021011913-A1 | Tau-protein targeting compounds and associated methods of use | 20190717 |
JP-2021521194-A | KRas G12C inhibitor and method of using it | 20180504 |
EP-3472162-A1 | Heteroaryl estrogen receptor modulators and uses thereof | 20160616 |
Complexity: | 169 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 168.05349212 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 168.05349212 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 67.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS