2-(Hydroxymethyl)-4-methylbenzimidazole - CAS 191794-20-4
Catalog: |
BB014839 |
Product Name: |
2-(Hydroxymethyl)-4-methylbenzimidazole |
CAS: |
191794-20-4 |
Synonyms: |
(4-methyl-1H-benzimidazol-2-yl)methanol; (4-methyl-1H-benzimidazol-2-yl)methanol |
IUPAC Name: | (4-methyl-1H-benzimidazol-2-yl)methanol |
Description: | 2-(Hydroxymethyl)-4-methylbenzimidazole (CAS# 191794-20-4) is a useful research chemical. |
Molecular Weight: | 162.19 |
Molecular Formula: | C9H10N2O |
Canonical SMILES: | CC1=C2C(=CC=C1)NC(=N2)CO |
InChI: | InChI=1S/C9H10N2O/c1-6-3-2-4-7-9(6)11-8(5-12)10-7/h2-4,12H,5H2,1H3,(H,10,11) |
InChI Key: | YEBKEULJXVMWID-UHFFFAOYSA-N |
Boiling Point: | 416.335 °C at 760 mmHg |
Density: | 1.296 g/cm3 |
MDL: | MFCD09971880 |
LogP: | 1.36360 |
Publication Number | Title | Priority Date |
US-2015004533-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
US-9323153-B2 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
WO-2013147286-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
US-2009203667-A1 | Pentadienamide derivatives | 20060713 |
EP-1572966-A2 | Complete biosynthetic gene set for synthesis of polyketide antibiotics, including the albicidin family, resistance genes and uses thereof | 20021018 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 162.079312947 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 162.079312947 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 48.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS