2-Hydroxy-3-methyl-5-nitropyridine - CAS 21901-34-8
Catalog: |
BB017196 |
Product Name: |
2-Hydroxy-3-methyl-5-nitropyridine |
CAS: |
21901-34-8 |
Synonyms: |
3-methyl-5-nitro-1H-pyridin-2-one |
IUPAC Name: | 3-methyl-5-nitro-1H-pyridin-2-one |
Description: | 2-Hydroxy-3-methyl-5-nitropyridine (CAS# 21901-34-8) is a useful research chemical. |
Molecular Weight: | 154.12 |
Molecular Formula: | C6H6N2O3 |
Canonical SMILES: | CC1=CC(=CNC1=O)[N+](=O)[O-] |
InChI: | InChI=1S/C6H6N2O3/c1-4-2-5(8(10)11)3-7-6(4)9/h2-3H,1H3,(H,7,9) |
InChI Key: | FPTYZBDNBMVYCL-UHFFFAOYSA-N |
Boiling Point: | 327.2 ℃ at 760 mmHg |
Density: | 1.36 g/cm3 |
MDL: | MFCD03095073 |
LogP: | 1.52700 |
GHS Hazard Statement: | H302 (86.36%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2019241575-A1 | Tyk2 inhibitors and uses thereof | 20170728 |
WO-2019023468-A1 | TYK2 INHIBITORS AND USES THEREOF | 20170728 |
AU-2016288534-A1 | Bicyclic heterocycle derivatives as bromodomain inhibitors | 20150702 |
CA-2989265-A1 | Bicyclic heterocycle derivatives as bromodomain inhibitors | 20150702 |
EP-3317266-A1 | Bicyclic heterocycle derivatives as bromodomain inhibitors | 20150702 |
Complexity: | 272 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 154.03784206 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 154.03784206 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 74.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS