2-Fluoro-N-methoxy-N-methyl-4-nitrobenzamide - CAS 774239-17-7
Catalog: |
BB035940 |
Product Name: |
2-Fluoro-N-methoxy-N-methyl-4-nitrobenzamide |
CAS: |
774239-17-7 |
Synonyms: |
2-fluoro-N-methoxy-N-methyl-4-nitrobenzamide; 2-fluoro-N-methoxy-N-methyl-4-nitrobenzamide |
IUPAC Name: | 2-fluoro-N-methoxy-N-methyl-4-nitrobenzamide |
Description: | 2-Fluoro-N-methoxy-N-methyl-4-nitrobenzamide (CAS# 774239-17-7 ) is a useful research chemical. |
Molecular Weight: | 228.18 |
Molecular Formula: | C9H9FN2O4 |
Canonical SMILES: | CN(C(=O)C1=C(C=C(C=C1)[N+](=O)[O-])F)OC |
InChI: | InChI=1S/C9H9FN2O4/c1-11(16-2)9(13)7-4-3-6(12(14)15)5-8(7)10/h3-5H,1-2H3 |
InChI Key: | CPNAYMYMDIQRLT-UHFFFAOYSA-N |
LogP: | 1.89050 |
Publication Number | Title | Priority Date |
EP-2202235-A1 | Bis(trimethylsilyl)phenyl compound or salt thereof, and use thereof | 20071011 |
JP-WO2009048123-A1 | Bis (trimethylsilyl) phenyl compound or salt thereof, and use thereof | 20071011 |
US-2010210591-A1 | Bis(trimethylsilyl)phenyl compound or salt thereof, and use thereof | 20071011 |
US-7855300-B2 | Bis(trimethylsilyl)phenyl compound or salt thereof, and use thereof | 20071011 |
CA-2521056-A1 | Hydrazone derivative | 20030331 |
Complexity: | 281 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 228.05463493 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 228.05463493 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 75.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS